Carbamic acid,N-1-naphthalenyl-, 1-methylethyl ester structure
|
Common Name | Carbamic acid,N-1-naphthalenyl-, 1-methylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16827-25-1 | Molecular Weight | 229.27400 | |
| Density | 1.167g/cm3 | Boiling Point | 325.8ºC at 760 mmHg | |
| Molecular Formula | C14H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.9ºC | |
| Name | propan-2-yl N-naphthalen-1-ylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 325.8ºC at 760 mmHg |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.27400 |
| Flash Point | 150.9ºC |
| Exact Mass | 229.11000 |
| PSA | 38.33000 |
| LogP | 3.86970 |
| Vapour Pressure | 0.000224mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | AEOQMGVPGAAJQS-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cccc2ccccc12 |
| HS Code | 2924299090 |
|---|
|
~%
Carbamic acid,N... CAS#:16827-25-1 |
| Literature: Spica; de Varda Gazzetta Chimica Italiana, 1887 , vol. 17, p. 165,168 |
|
~%
Carbamic acid,N... CAS#:16827-25-1 |
| Literature: Neuberg; Kansky Biochemische Zeitschrift, 1909 , vol. 20, p. 447 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| propan-2-yl naphthalen-1-ylcarbamate |