Carbanilic acid,3,5-bis(trifluoromethyl)-, isopropyl ester (7CI,8CI) structure
|
Common Name | Carbanilic acid,3,5-bis(trifluoromethyl)-, isopropyl ester (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 1683-20-1 | Molecular Weight | 315.21200 | |
| Density | 1.374g/cm3 | Boiling Point | 223.9ºC at 760 mmHg | |
| Molecular Formula | C12H11F6NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.2ºC | |
| Name | isopropyl (3,5-bis(trifluoromethyl)phenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 223.9ºC at 760 mmHg |
| Molecular Formula | C12H11F6NO2 |
| Molecular Weight | 315.21200 |
| Flash Point | 89.2ºC |
| Exact Mass | 315.06900 |
| PSA | 38.33000 |
| LogP | 4.75410 |
| Vapour Pressure | 0.0939mmHg at 25°C |
| Index of Refraction | 1.448 |
| InChIKey | WFLXBBIQCLQLNL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|
~%
Carbanilic acid... CAS#:1683-20-1 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-<3,5-Bis-trifluormethyl-phenyl>-carbamidsaeureisopropylester |