2,4,5,6,7-PENTABROMO-1H-BENZOIMIDAZOLE structure
|
Common Name | 2,4,5,6,7-PENTABROMO-1H-BENZOIMIDAZOLE | ||
|---|---|---|---|---|
| CAS Number | 16865-25-1 | Molecular Weight | 512.61600 | |
| Density | 2.912g/cm3 | Boiling Point | 541.3ºC at 760mmHg | |
| Molecular Formula | C7HBr5N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.2ºC | |
| Name | 2,4,5,6,7-pentabromo-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.912g/cm3 |
|---|---|
| Boiling Point | 541.3ºC at 760mmHg |
| Molecular Formula | C7HBr5N2 |
| Molecular Weight | 512.61600 |
| Flash Point | 281.2ºC |
| Exact Mass | 507.60600 |
| PSA | 28.68000 |
| LogP | 5.37540 |
| Vapour Pressure | 8.79E-12mmHg at 25°C |
| Index of Refraction | 1.797 |
| InChIKey | RKIBZFOZIJTIJU-UHFFFAOYSA-N |
| SMILES | Brc1nc2c(Br)c(Br)c(Br)c(Br)c2[nH]1 |
| HS Code | 2933990090 |
|---|
|
~71%
2,4,5,6,7-PENTA... CAS#:16865-25-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 18 p. 3997 - 4002 |
|
~%
2,4,5,6,7-PENTA... CAS#:16865-25-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 18 p. 3997 - 4002 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Benzimidazole,2,4,5,6,7-pentabromo |
| 5,6,7-pentabromobenzimidazole |
| 2,4,5,6,7-Pentabromobenzimidazole |
| 2,4,5,6,7-Pentabromo-1H-benzoimidazole |
| Benzimidazole,2,4,5,6,7-pentabromo-(8CI) |
| 2,3-DIHYDRO-1,4-BENZODIOXIN-5-YLMETHYLAMINE |