1,3,5,7-Tetrmethyl-adamantane structure
|
Common Name | 1,3,5,7-Tetrmethyl-adamantane | ||
|---|---|---|---|---|
| CAS Number | 1687-36-1 | Molecular Weight | 192.34000 | |
| Density | 0.969g/cm3 | Boiling Point | 216.4ºC at 760mmHg | |
| Molecular Formula | C14H24 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 77.3ºC | |
| Name | 1,3,5,7-tetramethyladamantane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.969g/cm3 |
|---|---|
| Boiling Point | 216.4ºC at 760mmHg |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.34000 |
| Flash Point | 77.3ºC |
| Exact Mass | 192.18800 |
| LogP | 4.39300 |
| Vapour Pressure | 0.206mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | UJSORZVCMMYGBS-UHFFFAOYSA-N |
| SMILES | CC12CC3(C)CC(C)(C1)CC(C)(C2)C3 |
| HS Code | 2902199090 |
|---|
| HS Code | 2902199090 |
|---|---|
| Summary | 2902199090 other cyclanes, cyclenes and cyclotherpenes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| tetramethyl-1,3,5,7 adamantane |
| 1,3,5,7-Tetramethyl-adamantan |
| 1,3,5,7-Tetramethyl-adamantane |
| ADAMANTANE,TETRAMETHYL |