(4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide
Modify Date: 2025-09-09 12:02:59
![(4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide Structure](https://www.chemsrc.com/extcaspic/208/1688733-91-6.png)
(4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide structure
|
Common Name | (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide | ||
|---|---|---|---|---|
| CAS Number | 1688733-91-6 | Molecular Weight | 484.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H21N2O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H21N2O2P |
|---|---|
| Molecular Weight | 484.5 |
| InChIKey | ZHVBUWOXLFVMES-UHFFFAOYSA-N |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2nc3cccc4c3n2-c2ccccc2O4)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide? |
| A: Molecular formula of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide is C31H21N2O2P. |
| Q: What is the CAS number of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide? |
| A: CAS number of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide is 1688733-91-6. |
| Q: What is the InChIKey of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide? |
| A: InChIKey of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide is ZHVBUWOXLFVMES-UHFFFAOYSA-N. |
| Q: What is the English name of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide? |
| A: The English name of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide is (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide. |
| Q: What is the molecular weight of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide? |
| A: Molecular weight of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide is 484.5. |
| Q: What is the Chinese name of 1688733-91-6? |
| A: Chinese name of 1688733-91-6 is 1688733-91-6. |
| Q: What is the SMILES notation of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide? |
| A: SMILES notation of (4-Dimidazo[4,5,1-kl]phenoxazin-1-yl)phenyl)diphenylphosphine oxide is O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2nc3cccc4c3n2-c2ccccc2O4)cc1. |