31-Norlanostenol structure
|
Common Name | 31-Norlanostenol | ||
|---|---|---|---|---|
| CAS Number | 16910-39-7 | Molecular Weight | 414.70700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H50O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 31-Norlanostenol31-Norlanostenol is a triterpenic compound isolated from the latex of Euphorbia officinarum. 31-Norlanostenol can act as efficient insect growth regulator on S. frugiperda and Tenebrio molitor[1][2]. |
| Name | dimethyl-4α,14α cholesta-5α ene-8 ol-3β |
|---|---|
| Synonym | More Synonyms |
| Description | 31-Norlanostenol is a triterpenic compound isolated from the latex of Euphorbia officinarum. 31-Norlanostenol can act as efficient insect growth regulator on S. frugiperda and Tenebrio molitor[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C29H50O |
|---|---|
| Molecular Weight | 414.70700 |
| Exact Mass | 414.38600 |
| PSA | 20.23000 |
| LogP | 8.16890 |
| InChIKey | IXVNEXDHXGHWLS-PMIIOQGLSA-N |
| SMILES | CC(C)CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)C1CC3 |
| 31-norlanost-8-en-3β-ol |
| (3S,4S,5S,10S,13R,14R,17R)-17-((R)-1,5-Dimethyl-hexyl)-4,10,13,14-tetramethyl-2,3,4,5,6,7,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| 4α-14α-dimethyl-5α-cholest-8-en-3β-ol |
| 4α,14α-dimethyl-5α-cholest-8-en-3β-ol |
| 29-norlanost-8-en-3β-ol |
| 31-norlanostenol |
| 4β-Demethyl-24,25-dihydrolanosterol |