3,5-dibromo-4-(4-methoxy-3-propan-2-ylphenoxy)aniline structure
|
Common Name | 3,5-dibromo-4-(4-methoxy-3-propan-2-ylphenoxy)aniline | ||
|---|---|---|---|---|
| CAS Number | 169113-83-1 | Molecular Weight | 415.12000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-dibromo-4-(4-methoxy-3-propan-2-ylphenoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17Br2NO2 |
|---|---|
| Molecular Weight | 415.12000 |
| Exact Mass | 412.96300 |
| PSA | 44.48000 |
| LogP | 6.29930 |
| InChIKey | OZJXANAUVBGUIM-UHFFFAOYSA-N |
| SMILES | COc1ccc(Oc2c(Br)cc(N)cc2Br)cc1C(C)C |
|
~%
3,5-dibromo-4-(... CAS#:169113-83-1 |
| Literature: Garcia Collazo, Ana-Maria; Koehler, Konrad F.; Garg, Neeraj; Faernegardh, Mathias; Husman, Bolette; Ye, Liu; Ljunggren, Jan; Mellstroem, Karin; Sandberg, Johnny; Grynfarb, Marlena; Ahola, Harri; Malm, Johan Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 5 p. 1240 - 1244 |
|
~%
3,5-dibromo-4-(... CAS#:169113-83-1 |
| Literature: Garcia Collazo, Ana-Maria; Koehler, Konrad F.; Garg, Neeraj; Faernegardh, Mathias; Husman, Bolette; Ye, Liu; Ljunggren, Jan; Mellstroem, Karin; Sandberg, Johnny; Grynfarb, Marlena; Ahola, Harri; Malm, Johan Bioorganic and Medicinal Chemistry Letters, 2006 , vol. 16, # 5 p. 1240 - 1244 |
| 3,5-Dibromo-4-(3'-isopropyl-4'-methoxyphenoxy)-aniline |
| Benzenamine,3,5-dibromo-4-[4-methoxy-3-(1-methylethyl)phenoxy] |