3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione
Modify Date: 2026-08-19 10:59:52
![3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione Structure](https://www.chemsrc.com/extcaspic/379/1691237-74-7.png)
3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione structure
|
Common Name | 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione | ||
|---|---|---|---|---|
| CAS Number | 1691237-74-7 | Molecular Weight | 274.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14N2O4 |
|---|---|
| Molecular Weight | 274.27 |
| InChIKey | QXMNHZHGDOSPLZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cn2c(=O)[nH]c3c(c2=O)COC3)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1691237-74-7? |
| A: Chinese name of 1691237-74-7 is 1691237-74-7. |
| Q: What is the molecular formula of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione? |
| A: Molecular formula of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione is C14H14N2O4. |
| Q: What is the English name of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione? |
| A: The English name of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione is 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione. |
| Q: What is the InChIKey of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione? |
| A: InChIKey of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione is QXMNHZHGDOSPLZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione? |
| A: CAS number of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione is 1691237-74-7. |
| Q: What is the molecular weight of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione? |
| A: Molecular weight of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione is 274.27. |
| Q: What is the SMILES notation of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione? |
| A: SMILES notation of 3-(4-Methoxybenzyl)-5,7-dihydrofuro[3,4-d]pyrimidine-2,4(1H,3H)-dione is COc1ccc(Cn2c(=O)[nH]c3c(c2=O)COC3)cc1. |