(R)-Zanubrutinib structure
|
Common Name | (R)-Zanubrutinib | ||
|---|---|---|---|---|
| CAS Number | 1691249-44-1 | Molecular Weight | 471.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H29N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (R)-Zanubrutinib(R)-Zanubrutinib is the R enantiomer of Zanubrutinib. Zanubrutinib is a selective Bruton tyrosine kinase (BTK) inhibitor. |
| Name | (R)-Zanubrutinib |
|---|
| Description | (R)-Zanubrutinib is the R enantiomer of Zanubrutinib. Zanubrutinib is a selective Bruton tyrosine kinase (BTK) inhibitor. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C27H29N5O3 |
|---|---|
| Molecular Weight | 471.55 |
| InChIKey | RNOAOAWBMHREKO-JOCHJYFZSA-N |
| SMILES | C=CC(=O)N1CCC(C2CCNc3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)nn32)CC1 |