Bis(4-aminophenyl) terephthalate structure
|
Common Name | Bis(4-aminophenyl) terephthalate | ||
|---|---|---|---|---|
| CAS Number | 16926-73-1 | Molecular Weight | 348.352 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 608.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H16N2O4 | Melting Point | 224 °C(dec.) | |
| MSDS | N/A | Flash Point | 286.3±26.4 °C | |
| Name | Bis(4-aminophenyl) terephthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 608.6±50.0 °C at 760 mmHg |
| Melting Point | 224 °C(dec.) |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.352 |
| Flash Point | 286.3±26.4 °C |
| Exact Mass | 348.110992 |
| PSA | 104.64000 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.675 |
| InChIKey | CFTXGNJIXHFHTH-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OC(=O)c2ccc(C(=O)Oc3ccc(N)cc3)cc2)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1,4-Benzenedicarboxylic acid, bis(4-aminophenyl) ester |
| Bis(4-aminophenyl) terephthalate |
| bis(4-aminophenyl) benzene-1,4-dicarboxylate |