Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate
Modify Date: 2026-07-15 10:17:19
Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate structure
|
Common Name | Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1692949-92-0 | Molecular Weight | 331.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20F3NO3 |
|---|---|
| Molecular Weight | 331.33 |
| InChIKey | MIOVJQBVQWPSPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(OCC(F)(F)F)ccc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate? |
| A: Molecular weight of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate is 331.33. |
| Q: What is the CAS number of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate? |
| A: CAS number of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate is 1692949-92-0. |
| Q: What is the English name of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate? |
| A: The English name of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate is Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate. |
| Q: What is the InChIKey of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate? |
| A: InChIKey of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate is MIOVJQBVQWPSPZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate? |
| A: SMILES notation of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate is CC(C)(C)OC(=O)N1CCc2cc(OCC(F)(F)F)ccc2C1. |
| Q: What is the Chinese name of 1692949-92-0? |
| A: Chinese name of 1692949-92-0 is 1692949-92-0. |
| Q: What is the molecular formula of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate? |
| A: Molecular formula of Tert-butyl 6-(2,2,2-trifluoroethoxy)-3,4-dihydroisoquinoline-2(1H)-carboxylate is C16H20F3NO3. |