1-(4-Iodophenyl)pentane-1,3-dione
Modify Date: 2025-09-13 08:29:48
1-(4-Iodophenyl)pentane-1,3-dione structure
|
Common Name | 1-(4-Iodophenyl)pentane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1694792-30-7 | Molecular Weight | 302.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-Iodophenyl)pentane-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11IO2 |
|---|---|
| Molecular Weight | 302.11 |
| InChIKey | MLAQZLKAESDKTR-UHFFFAOYSA-N |
| SMILES | CCC(=O)CC(=O)c1ccc(I)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(4-Iodophenyl)pentane-1,3-dione? |
| A: SMILES notation of 1-(4-Iodophenyl)pentane-1,3-dione is CCC(=O)CC(=O)c1ccc(I)cc1. |
| Q: What is the Chinese name of 1694792-30-7? |
| A: Chinese name of 1694792-30-7 is 1694792-30-7. |
| Q: What is the molecular formula of 1-(4-Iodophenyl)pentane-1,3-dione? |
| A: Molecular formula of 1-(4-Iodophenyl)pentane-1,3-dione is C11H11IO2. |
| Q: What is the InChIKey of 1-(4-Iodophenyl)pentane-1,3-dione? |
| A: InChIKey of 1-(4-Iodophenyl)pentane-1,3-dione is MLAQZLKAESDKTR-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-Iodophenyl)pentane-1,3-dione? |
| A: The English name of 1-(4-Iodophenyl)pentane-1,3-dione is 1-(4-Iodophenyl)pentane-1,3-dione. |
| Q: What is the molecular weight of 1-(4-Iodophenyl)pentane-1,3-dione? |
| A: Molecular weight of 1-(4-Iodophenyl)pentane-1,3-dione is 302.11. |
| Q: What is the CAS number of 1-(4-Iodophenyl)pentane-1,3-dione? |
| A: CAS number of 1-(4-Iodophenyl)pentane-1,3-dione is 1694792-30-7. |