Boc-L-Val-ONp structure
|
Common Name | Boc-L-Val-ONp | ||
|---|---|---|---|---|
| CAS Number | 16948-40-6 | Molecular Weight | 338.356 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 476.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H22N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1±24.6 °C | |
| Name | (4-nitrophenyl) (2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 476.8±30.0 °C at 760 mmHg |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.356 |
| Flash Point | 242.1±24.6 °C |
| Exact Mass | 338.147797 |
| PSA | 110.45000 |
| LogP | 3.76 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | ALJZEMRUAOJSPP-ZDUSSCGKSA-N |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)Oc1ccc([N+](=O)[O-])cc1 |
| Storage condition | -20°C |
| HS Code | 2924299090 |
|---|
|
~%
Boc-L-Val-ONp CAS#:16948-40-6 |
| Literature: Wan, Qian; Chen, Jin; Yuan, Yu; Danishefskr, Samuel J. Journal of the American Chemical Society, 2008 , vol. 130, # 47 p. 15814 - 15816 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Valine, N-[(1,1-dimethylethoxy)carbonyl]-, 4-nitrophenyl ester |
| Boc-Val-ONp |
| Boc-L-Val-OpNP |
| Boc-L-valine p-nitrophenyl ester |
| Boc-Val p-nitrophenyl ester |
| 4-Nitrophenyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}valinate |
| N-t-butoxycarbonyl-L-valine p-nitrophenyl ester |
| AmbotzBAA6030 |
| tert-butoxycarbonyl-L-valine p-nitrophenylester |