2,4,6(1H,3H,5H)-Pyrimidinetrione,5-bromo-5-(1-methylethyl)- structure
|
Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-bromo-5-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 16952-71-9 | Molecular Weight | 249.06200 | |
| Density | 1.628g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.628g/cm3 |
|---|---|
| Molecular Formula | C7H9BrN2O3 |
| Molecular Weight | 249.06200 |
| Exact Mass | 247.98000 |
| PSA | 75.27000 |
| LogP | 0.79970 |
| Index of Refraction | 1.528 |
| InChIKey | VDWQDWRNMYXLOV-UHFFFAOYSA-N |
| SMILES | CC(C)C1(Br)C(=O)NC(=O)NC1=O |
| HS Code | 2933540000 |
|---|
|
~%
2,4,6(1H,3H,5H)... CAS#:16952-71-9 |
| Literature: Cox et al. Journal of the Chemical Society, 1931 , p. 1870,1871 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-bromo-5-isopropyl-barbituric acid |
| 5-Brom-5-isopropyl-barbitursaeure |