4-Chloro-methyl-dioxo benzenebutanoic acid ethyl ester structure
|
Common Name | 4-Chloro-methyl-dioxo benzenebutanoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 169544-41-6 | Molecular Weight | 268.69300 | |
| Density | 1.241g/cm3 | Boiling Point | 397.6ºC at 760mmHg | |
| Molecular Formula | C13H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4ºC | |
| Name | ethyl 4-(4-chlorophenyl)-3-methyl-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 397.6ºC at 760mmHg |
| Molecular Formula | C13H13ClO4 |
| Molecular Weight | 268.69300 |
| Flash Point | 161.4ºC |
| Exact Mass | 268.05000 |
| PSA | 60.44000 |
| LogP | 2.29100 |
| Vapour Pressure | 1.56E-06mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | CWGPJEWLCBNHJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C(C)C(=O)c1ccc(Cl)cc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 2,4-dioxo-3-methyl-4-(4-chlorophenyl)butanoate |
| Ethyl 3-(4-chlorobenzoyl)-3-methylpyruvate |
| 2-oxo-3-(4-chlorobenzoyl)-ethyl butyrate |
| 4-(4-chlorophenyl)-3-methyl-2,4-dioxo-butyric acid ethyl ester |
| Ethyl 4-(4-chlorophenyl)-3-methyl-2,4-dioxo-butyrate |