Benzene,1,4-bis[(2-chloroethyl)thio]-2,3,5,6-tetrafluoro- structure
|
Common Name | Benzene,1,4-bis[(2-chloroethyl)thio]-2,3,5,6-tetrafluoro- | ||
|---|---|---|---|---|
| CAS Number | 16956-51-7 | Molecular Weight | 339.20000 | |
| Density | 1.5g/cm3 | Boiling Point | 288.2ºC at 760 mmHg | |
| Molecular Formula | C10H8Cl2F4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.1ºC | |
| Name | 1,4-bis(2-chloroethylsulfanyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 288.2ºC at 760 mmHg |
| Molecular Formula | C10H8Cl2F4S2 |
| Molecular Weight | 339.20000 |
| Flash Point | 128.1ºC |
| Exact Mass | 337.93800 |
| PSA | 50.60000 |
| LogP | 4.90480 |
| Vapour Pressure | 0.00411mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | KEWWKWCIIKMQFU-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(SCCCl)c(F)c(F)c1SCCCl |
|
~%
Benzene,1,4-bis... CAS#:16956-51-7 |
| Literature: Popp,F.D. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 986 |
| 1,4-Bis<(2-chloroethyl)thio>-2,3,5,6-tetrafluorobenzene |
| 1,4-bis[(2-chloroethyl)sulfanyl]-2,3,5,6-tetrafluorobenzene |