1,1',4,4'-Tetrahydro-1,1'-dimethyl-4,4'-bipyridine structure
|
Common Name | 1,1',4,4'-Tetrahydro-1,1'-dimethyl-4,4'-bipyridine | ||
|---|---|---|---|---|
| CAS Number | 16968-09-5 | Molecular Weight | 188.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-methyl-4-(1-methyl-4H-pyridin-4-yl)-4H-pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2 |
|---|---|
| Molecular Weight | 188.26900 |
| Exact Mass | 188.13100 |
| PSA | 6.48000 |
| LogP | 2.04020 |
| InChIKey | KJZHLKZXRSCVKH-UHFFFAOYSA-N |
| SMILES | CN1C=CC(C2C=CN(C)C=C2)C=C1 |
| HS Code | 2933399090 |
|---|
|
~%
1,1',4,4'-Tetra... CAS#:16968-09-5 |
| Literature: Akiyama, Kimio; Ishii, Toru; Tero-Kubota, Shozo; Ikegami, Yusaku Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 12 p. 3535 - 3539 |
|
~%
1,1',4,4'-Tetra... CAS#:16968-09-5 |
| Literature: Emmert; Buchert Chemische Berichte, 1921 , vol. 54, p. 206 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N'-Dimethyl-dihydro-4,4'-bipyridyl |
| 1,1'-dimethyl-1,4,1',4'-tetrahydro-[4,4']bipyridinyl |
| 1,1'-Dimethyl-1,4,1',4'-tetrahydro-[4,4']bipyridyl |
| methyl viologen |
| 1,1'-Dimethyl-1,1'-dihydro-4,4'-bipyridyl |
| 4,4'-Bipyridine,1,1',4,4'-tetrahydro-1,1'-dimethyl |
| 4,4'-dimer of 1-methylpyridinyl |