6-(3,5-Dimethylphenyl)pyrimidin-4-ol
Modify Date: 2026-08-01 00:21:29
6-(3,5-Dimethylphenyl)pyrimidin-4-ol structure
|
Common Name | 6-(3,5-Dimethylphenyl)pyrimidin-4-ol | ||
|---|---|---|---|---|
| CAS Number | 1697463-91-4 | Molecular Weight | 200.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(3,5-Dimethylphenyl)pyrimidin-4-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O |
|---|---|
| Molecular Weight | 200.24 |
| InChIKey | YMEFRMCRFGAEDX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(-c2cc(=O)[nH]cn2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol? |
| A: Molecular formula of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol is C12H12N2O. |
| Q: What is the InChIKey of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol? |
| A: InChIKey of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol is YMEFRMCRFGAEDX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol? |
| A: CAS number of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol is 1697463-91-4. |
| Q: What is the English name of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol? |
| A: The English name of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol is 6-(3,5-Dimethylphenyl)pyrimidin-4-ol. |
| Q: What is the Chinese name of 1697463-91-4? |
| A: Chinese name of 1697463-91-4 is 1697463-91-4. |
| Q: What is the molecular weight of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol? |
| A: Molecular weight of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol is 200.24. |
| Q: What is the SMILES notation of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol? |
| A: SMILES notation of 6-(3,5-Dimethylphenyl)pyrimidin-4-ol is Cc1cc(C)cc(-c2cc(=O)[nH]cn2)c1. |