Robalzotan structure
|
Common Name | Robalzotan | ||
|---|---|---|---|---|
| CAS Number | 169758-66-1 | Molecular Weight | 486.48800 | |
| Density | 1.27g/cm3 | Boiling Point | 429.9ºC at 760 mmHg | |
| Molecular Formula | C22H31FN2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.8ºC | |
| Name | (3R)-3-[di(cyclobutyl)amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 429.9ºC at 760 mmHg |
| Molecular Formula | C22H31FN2O9 |
| Molecular Weight | 486.48800 |
| Flash Point | 213.8ºC |
| Exact Mass | 486.20100 |
| PSA | 179.85000 |
| LogP | 1.14850 |
| Vapour Pressure | 1.36E-07mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | MQTUXRKNJYPMCG-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc(F)c2c1CC(N(C1CCC1)C1CCC1)CO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Robalzotan |
| UNII-I18M56OGME |