Cyclobutaneacetic acid,3-acetyl-2,2-dimethyl-, methyl ester structure
|
Common Name | Cyclobutaneacetic acid,3-acetyl-2,2-dimethyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 16978-11-3 | Molecular Weight | 198.25900 | |
| Density | 1g/cm3 | Boiling Point | 248.9ºC at 760mmHg | |
| Molecular Formula | C11H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.3ºC | |
| Name | methyl 2-(3-acetyl-2,2-dimethylcyclobutyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1g/cm3 |
|---|---|
| Boiling Point | 248.9ºC at 760mmHg |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.25900 |
| Flash Point | 101.3ºC |
| Exact Mass | 198.12600 |
| PSA | 43.37000 |
| LogP | 1.80080 |
| Vapour Pressure | 0.0236mmHg at 25°C |
| Index of Refraction | 1.444 |
| InChIKey | DVAHCHCZPNEYNF-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CC(C(C)=O)C1(C)C |
| HS Code | 2918300090 |
|---|
|
~%
Cyclobutaneacet... CAS#:16978-11-3 |
| Literature: Le-Van-Thoi Annales de Chimie (Cachan, France), 1955 , vol. <12> 10, p. 35,51, 54 Full Text Show Details Brus; Le Van Thoi Proces-Verbeaux Soc. Sci. phys. nat. Bordeaux, p. 79 |
|
~%
Cyclobutaneacet... CAS#:16978-11-3 |
| Literature: Pirrung, Michael C.; DeAmicis, Carl V. Heterocycles, 1987 , vol. 25, p. 189 - 192 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (+-)-(3c-Acetyl-2,2-dimethyl-cyclobut-r-yl)-essigsaeure-methylester |
| Methyl pinonate |
| methyl [(1SR,3SR)-3-acetyl-2,2-dimethylcyclobutyl]acetate |
| (+-)-(2.2-Dimethyl-3c-acetyl-cyclobutyl-(r))-essigsaeure-methylester |
| (+-)-(3c-acetyl-2,2-dimethyl-cyclobut-r-yl)-acetic acid methyl ester |
| Cyclobutaneacetic acid,3-acetyl-2,2-dimethyl-,methyl ester |
| methyl(3-acetyl-2,2-dimethylcyclobutyl)acetate |
| pinonic acid methyl ester |
| EINECS 241-055-2 |
| (+-)-cis-Pinonsaeure-methylester |
| (+/-)-methyl cis-pinonate |