N-methyl-4-nitro-N-[(4-nitrophenyl)diazenyl]aniline structure
|
Common Name | N-methyl-4-nitro-N-[(4-nitrophenyl)diazenyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 16978-82-8 | Molecular Weight | 301.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-methyl-4-nitro-N-[(4-nitrophenyl)diazenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H11N5O4 |
|---|---|
| Molecular Weight | 301.25800 |
| Exact Mass | 301.08100 |
| PSA | 119.60000 |
| LogP | 4.68450 |
| InChIKey | SOAWPNGIWQTSEH-UHFFFAOYSA-N |
| SMILES | CN(N=Nc1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
|
~%
N-methyl-4-nitr... CAS#:16978-82-8 |
| Literature: Journal of the Society of Chemical Industry, London, , vol. 57, p. 351,352 |
|
~%
N-methyl-4-nitr... CAS#:16978-82-8 |
| Literature: Journal of the Society of Chemical Industry, London, , vol. 57, p. 351,352 |
| 3-methyl-1,3-bis-(4-nitro-phenyl)-triazene |
| 4.4'-Dinitro-N-methyl-diazoaminobenzol |
| Triazene,3-methyl-1,3-bis(4-nitrophenyl) |
| 1-Triazene,3-methyl-1,3-bis(4-nitrophenyl) |
| 1,3-Bis(p-nitrophenyl)-3-methyltriazen |
| (1E)-3-Methyl-1,3-bis(4-nitrophenyl)-1-triazene |