3(2H)-Pyridazinone,5-amino-6-chloro-2-phenyl- structure
|
Common Name | 3(2H)-Pyridazinone,5-amino-6-chloro-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1698-59-5 | Molecular Weight | 221.64300 | |
| Density | 1.42g/cm3 | Boiling Point | 348.8ºC at 760mmHg | |
| Molecular Formula | C10H8ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.8ºC | |
| Name | 5-amino-6-chloro-2-phenylpyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 348.8ºC at 760mmHg |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.64300 |
| Flash Point | 164.8ºC |
| Exact Mass | 221.03600 |
| PSA | 60.91000 |
| LogP | 2.04930 |
| Vapour Pressure | 4.9E-05mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | BDOCEPSNUBOONQ-UHFFFAOYSA-N |
| SMILES | Nc1cc(=O)n(-c2ccccc2)nc1Cl |
| HS Code | 2933990090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-6-chlor-2-phenyl-2H-pyridazin-3-on |
| 5-amino-6-chloro-2-phenyl-2H-pyridazin-3-one |