Methyl 3-(3-Hydroxy-4-Methoxyphenyl)acrylate structure
|
Common Name | Methyl 3-(3-Hydroxy-4-Methoxyphenyl)acrylate | ||
|---|---|---|---|---|
| CAS Number | 16980-82-8 | Molecular Weight | 208.21100 | |
| Density | 1.204g/cm3 | Boiling Point | 369.8ºC at 760mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.1ºC | |
| Name | methyl (E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 369.8ºC at 760mmHg |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 145.1ºC |
| Exact Mass | 208.07400 |
| PSA | 55.76000 |
| LogP | 1.58700 |
| Vapour Pressure | 5.44E-06mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | JTLOUXXZZFFBBW-GQCTYLIASA-N |
| SMILES | COC(=O)C=Cc1ccc(OC)c(O)c1 |
| Storage condition | -20°C |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Methyl isoferulate |
| Methyl 3-Hydroxy-4-methoxycinnamate |
| Cinnamic acid,3-hydroxy-4-methoxy-,methyl ester |