1H-Azepin-1-amine,N-[[4-(dimethylamino)phenyl]methylene]hexahydro- structure
|
Common Name | 1H-Azepin-1-amine,N-[[4-(dimethylamino)phenyl]methylene]hexahydro- | ||
|---|---|---|---|---|
| CAS Number | 16987-27-2 | Molecular Weight | 245.36300 | |
| Density | 1.01g/cm3 | Boiling Point | 404ºC at 760mmHg | |
| Molecular Formula | C15H23N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.1ºC | |
| Name | 4-(azepan-1-yliminomethyl)-N,N-dimethyl-aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 404ºC at 760mmHg |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.36300 |
| Flash Point | 198.1ºC |
| Exact Mass | 245.18900 |
| PSA | 18.84000 |
| LogP | 2.90040 |
| Vapour Pressure | 9.74E-07mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | RVOJEUDQQHLIER-SSZFMOIBSA-N |
| SMILES | CN(C)c1ccc(C=NN2CCCCCC2)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| azepan-1-yl-(4-dimethylamino-benzylidene)-amine |