DC1 structure
|
Common Name | DC1 | ||
|---|---|---|---|---|
| CAS Number | 169901-27-3 | Molecular Weight | 638.14 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H28ClN5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DC1DC1, an analogue of the minor groove-binding DNA alkylator CC-1065, is an antibody conjugate of cytotoxic DNA alkylators for the targeted treatment of cancer. |
| Name | DC1 |
|---|
| Description | DC1, an analogue of the minor groove-binding DNA alkylator CC-1065, is an antibody conjugate of cytotoxic DNA alkylators for the targeted treatment of cancer. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C34H28ClN5O4S |
|---|---|
| Molecular Weight | 638.14 |
| InChIKey | ZASLXALGERLDLT-HXUWFJFHSA-N |
| SMILES | O=C(CCS)Nc1ccc2[nH]c(C(=O)Nc3ccc4[nH]c(C(=O)N5CC(CCl)c6c5cc(O)c5ccccc65)cc4c3)cc2c1 |
| Storage condition | 2-8℃ |