Fmoc-D-2,4-Difluorophe
Modify Date: 2026-08-02 10:04:34
Fmoc-D-2,4-Difluorophe structure
|
Common Name | Fmoc-D-2,4-Difluorophe | ||
|---|---|---|---|---|
| CAS Number | 1699151-15-9 | Molecular Weight | 423.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H19F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Fmoc-D-2,4-Difluorophe |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H19F2NO4 |
|---|---|
| Molecular Weight | 423.4 |
| InChIKey | QFBGJWYZYONGDV-UHFFFAOYSA-N |
| SMILES | O=C(NC(Cc1ccc(F)cc1F)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Fmoc-D-2,4-Difluorophe? |
| A: The English name of Fmoc-D-2,4-Difluorophe is Fmoc-D-2,4-Difluorophe. |
| Q: What is the molecular weight of Fmoc-D-2,4-Difluorophe? |
| A: Molecular weight of Fmoc-D-2,4-Difluorophe is 423.4. |
| Q: What is the molecular formula of Fmoc-D-2,4-Difluorophe? |
| A: Molecular formula of Fmoc-D-2,4-Difluorophe is C24H19F2NO4. |
| Q: What is the InChIKey of Fmoc-D-2,4-Difluorophe? |
| A: InChIKey of Fmoc-D-2,4-Difluorophe is QFBGJWYZYONGDV-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Fmoc-D-2,4-Difluorophe? |
| A: SMILES notation of Fmoc-D-2,4-Difluorophe is O=C(NC(Cc1ccc(F)cc1F)C(=O)O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the CAS number of Fmoc-D-2,4-Difluorophe? |
| A: CAS number of Fmoc-D-2,4-Difluorophe is 1699151-15-9. |
| Q: What is the Chinese name of 1699151-15-9? |
| A: Chinese name of 1699151-15-9 is 1699151-15-9. |