2-Phenanthreneaceticacid, 1,2,3,4-tetrahydro-a,1-dioxo-, ethyl ester structure
|
Common Name | 2-Phenanthreneaceticacid, 1,2,3,4-tetrahydro-a,1-dioxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 16992-94-2 | Molecular Weight | 296.31700 | |
| Density | 1.262g/cm3 | Boiling Point | 486.6ºC at 760 mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.8ºC | |
| Name | ethyl 2-oxo-2-(1-oxo-3,4-dihydro-2H-phenanthren-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 486.6ºC at 760 mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 216.8ºC |
| Exact Mass | 296.10500 |
| PSA | 60.44000 |
| LogP | 2.71710 |
| Vapour Pressure | 1.28E-09mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | DGMXRGBSORJOLJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1CCc2c(ccc3ccccc23)C1=O |
|
~63%
2-Phenanthrenea... CAS#:16992-94-2 |
| Literature: Kumar, Satish; Sharma, K. S. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1981 , vol. 20, # 5 p. 380 - 383 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Ethyl 1-oxo-1,2,3,4-tetrahydrophenanthrene-2-glyoxalate |