4-Pyrimidinamine,5-(4-chlorophenyl)-6-methyl- structure
|
Common Name | 4-Pyrimidinamine,5-(4-chlorophenyl)-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 17005-45-7 | Molecular Weight | 219.67000 | |
| Density | 1.279g/cm3 | Boiling Point | 362.7ºC at 760mmHg | |
| Molecular Formula | C11H10ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | 5-(4-chlorophenyl)-6-methylpyrimidin-4-amine |
|---|
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760mmHg |
| Molecular Formula | C11H10ClN3 |
| Molecular Weight | 219.67000 |
| Flash Point | 173.2ºC |
| Exact Mass | 219.05600 |
| PSA | 51.80000 |
| LogP | 3.26880 |
| Vapour Pressure | 1.9E-05mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | UVLCSOKOFOZRSP-UHFFFAOYSA-N |
| SMILES | Cc1ncnc(N)c1-c1ccc(Cl)cc1 |
|
~%
4-Pyrimidinamin... CAS#:17005-45-7 |
| Literature: Journal of Organic Chemistry, , vol. 18, p. 133,136 |