Pseudobufarenogin structure
|
Common Name | Pseudobufarenogin | ||
|---|---|---|---|---|
| CAS Number | 17008-69-4 | Molecular Weight | 416.507 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 635.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.7±25.0 °C | |
Use of PseudobufarenoginPseudobufarenogin is a natural compound extracted from toad species with unknown details. |
| Name | 5-[(3S,5R,8R,9S,10S,12R,13S,14S,17R)-3,12,14-trihydroxy-10,13-dimethyl-11-oxo-2,3,4,5,6,7,8,9,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Pseudobufarenogin is a natural compound extracted from toad species with unknown details. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 635.8±55.0 °C at 760 mmHg |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.507 |
| Flash Point | 218.7±25.0 °C |
| Exact Mass | 416.219879 |
| PSA | 107.97000 |
| LogP | 0.71 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | SOGONHOGEFLVPE-BHZHDSHXSA-N |
| SMILES | CC12CCC(O)CC1CCC1C2C(=O)C(O)C2(C)C(c3ccc(=O)oc3)CCC12O |
| Storage condition | 2-8℃ |
| Bufarenogin |
| Bufa-20,22-dienolide, 3,12,14-trihydroxy-11-oxo-, (3β,5β,12α)- |
| Bufalitoxin |
| (3β,5β,12α)-3,12,14-Trihydroxy-11-oxobufa-20,22-dienolide |
| Bufalin 3-suberylarginate |
| Pseudobufarenogin |