5-Ethyl-5-(1-ethylpropyl)barbituric acid structure
|
Common Name | 5-Ethyl-5-(1-ethylpropyl)barbituric acid | ||
|---|---|---|---|---|
| CAS Number | 17013-37-5 | Molecular Weight | 226.27200 | |
| Density | 1.081g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethyl-5-pentan-3-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.081g/cm3 |
|---|---|
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.27200 |
| Exact Mass | 226.13200 |
| PSA | 82.25000 |
| LogP | 1.73680 |
| Index of Refraction | 1.465 |
| InChIKey | DARHAYISHKNKKE-UHFFFAOYSA-N |
| SMILES | CCC(CC)C1(CC)C(=O)NC(=O)NC1=O |
| HS Code | 2933540000 |
|---|
|
~%
5-Ethyl-5-(1-et... CAS#:17013-37-5 |
| Literature: Shonle; Keltch; Swanson Journal of the American Chemical Society, 1930 , vol. 52, p. 2443 |
|
~%
5-Ethyl-5-(1-et... CAS#:17013-37-5 |
| Literature: Shonle; Keltch; Swanson Journal of the American Chemical Society, 1930 , vol. 52, p. 2443 |
|
~%
5-Ethyl-5-(1-et... CAS#:17013-37-5 |
| Literature: Shonle; Keltch; Swanson Journal of the American Chemical Society, 1930 , vol. 52, p. 2443 |
|
~%
5-Ethyl-5-(1-et... CAS#:17013-37-5 |
| Literature: Shonle; Keltch; Swanson Journal of the American Chemical Society, 1930 , vol. 52, p. 2443 |
|
~%
5-Ethyl-5-(1-et... CAS#:17013-37-5 |
| Literature: Bayer and Co. Patent: DE293163 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 800 |
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 5-(1-Aethyl-propyl)-5-aethyl-barbitursaeure |
| 5-Aethyl-5-(1-aethyl-propyl)-barbitursaeure |
| Isomebumal |
| 5-ethyl-5-(1-ethyl-propyl)-pyrimidine-2,4,6-trione |
| 2,4,6(1H,3H,5H)-Pyrimidinetrione,5-ethyl-5-(1-ethylpropyl) |
| UNII-0J1XR8C3A5 |
| 5-ethyl-5-(1-ethyl-propyl)-barbituric acid |
| Pentobarbital impurity,5-ethyl-5-(1-ethylpropyl) barbituric acid-[USP] |