2-chloro-3-methylnaphthalene-1,4-dione
2-chloro-3-methylnaphthalene-1,4-dione structure
|
Common Name | 2-chloro-3-methylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 17015-99-5 | Molecular Weight | 206.62500 | |
| Density | 1.36g/cm3 | Boiling Point | 315.3ºC at 760mmHg | |
| Molecular Formula | C11H7ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-3-methylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 315.3ºC at 760mmHg |
| Molecular Formula | C11H7ClO2 |
| Molecular Weight | 206.62500 |
| Flash Point | 132.5ºC |
| Exact Mass | 206.01300 |
| PSA | 34.14000 |
| LogP | 2.57840 |
| Vapour Pressure | 0.00044mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | WYIOQBYLZGEHCV-UHFFFAOYSA-N |
| SMILES | CC1=C(Cl)C(=O)c2ccccc2C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibitory concentration against lipid peroxidation in rat
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL834638
|
|
Name: Inhibitory concentration against bovine serum albumin glycation was determined
Source: ChEMBL
Target: Bos taurus
External Id: CHEMBL824936
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Chlor-3-methyl-[1,4]naphthochinon |
| 2-Chloro-3-methylnaphthoquinone |
| 2-methyl-3-chloronaphthoquinone |
| 2-Chloro-3-methyl-1,4-naphthoquinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: InChIKey of 2-chloro-3-methylnaphthalene-1,4-dione is WYIOQBYLZGEHCV-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: Polar surface area (PSA) of 2-chloro-3-methylnaphthalene-1,4-dione is 34.14000. |
| Q: What is the molecular weight of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: Molecular weight of 2-chloro-3-methylnaphthalene-1,4-dione is 206.62500. |
| Q: What is the Chinese name of 17015-99-5? |
| A: Chinese name of 17015-99-5 is 17015-99-5. |
| Q: What is the boiling point of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: Boiling point of 2-chloro-3-methylnaphthalene-1,4-dione is 315.3ºC at 760mmHg. |
| Q: What is the SMILES notation of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: SMILES notation of 2-chloro-3-methylnaphthalene-1,4-dione is CC1=C(Cl)C(=O)c2ccccc2C1=O. |
| Q: What is the LogP of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: LogP of 2-chloro-3-methylnaphthalene-1,4-dione is 2.57840. |
| Q: What is the molecular formula of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: Molecular formula of 2-chloro-3-methylnaphthalene-1,4-dione is C11H7ClO2. |
| Q: What is the English name of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: The English name of 2-chloro-3-methylnaphthalene-1,4-dione is 2-chloro-3-methylnaphthalene-1,4-dione. |
| Q: What is the CAS number of 2-chloro-3-methylnaphthalene-1,4-dione? |
| A: CAS number of 2-chloro-3-methylnaphthalene-1,4-dione is 17015-99-5. |