2,2',4,4',5,5'-HEXAMETHOXYBIPHENYL structure
|
Common Name | 2,2',4,4',5,5'-HEXAMETHOXYBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 1702-67-6 | Molecular Weight | 334.36400 | |
| Density | 1.119g/cm3 | Boiling Point | 402.567ºC at 760 mmHg | |
| Molecular Formula | C18H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.922ºC | |
| Name | 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 402.567ºC at 760 mmHg |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.36400 |
| Flash Point | 158.922ºC |
| Exact Mass | 334.14200 |
| PSA | 55.38000 |
| LogP | 3.40520 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | DLFXWDJAIBAVOY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2=CC(=C(C=C2OC)OC)OC)OC)OC |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2.4.5.2'.4'.5'-Hexamethoxy-diphenyl |
| 2,2',4,4',5,5'-hexamethoxy-1,1'-biphenyl |
| 2,2',4,4',5,5'-Hexamethoxybiphenyl |
| 2,4,5,2',4',5'-Hexamethoxy-biphenyl |
| 1,1'-Biphenyl,2,2',4,4',5,5'-hexamethoxy |