2,2',4,4',5,5'-HEXAMETHOXYBIPHENYL
2,2',4,4',5,5'-HEXAMETHOXYBIPHENYL structure
|
Common Name | 2,2',4,4',5,5'-HEXAMETHOXYBIPHENYL | ||
|---|---|---|---|---|
| CAS Number | 1702-67-6 | Molecular Weight | 334.36400 | |
| Density | 1.119g/cm3 | Boiling Point | 402.567ºC at 760 mmHg | |
| Molecular Formula | C18H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.922ºC | |
Summary: The Chinese name of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is 2,2',4,4',5,5'-hexamethoxybiphenyl, with CAS number 1702-67-6, molecular formula C18H22O6, and molecular weight 334.36400. The boiling point is 402.567°C at 760 mmHg, and the density is 1.119g/cm3. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.119g/cm3 |
|---|---|
| Boiling Point | 402.567ºC at 760 mmHg |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.36400 |
| Flash Point | 158.922ºC |
| Exact Mass | 334.14200 |
| PSA | 55.38000 |
| LogP | 3.40520 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | DLFXWDJAIBAVOY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C2=CC(=C(C=C2OC)OC)OC)OC)OC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2909309090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2.4.5.2'.4'.5'-Hexamethoxy-diphenyl |
| 2,2',4,4',5,5'-hexamethoxy-1,1'-biphenyl |
| 2,2',4,4',5,5'-Hexamethoxybiphenyl |
| 2,4,5,2',4',5'-Hexamethoxy-biphenyl |
| 1,1'-Biphenyl,2,2',4,4',5,5'-hexamethoxy |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1702-67-6? |
| A: Chinese name of 1702-67-6 is 1702-67-6. |
| Q: What is the English name of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: The English name of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene. |
| Q: What English synonyms does 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene have? |
| A: English synonyms of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene: 2.4.5.2'.4'.5'-Hexamethoxy-diphenyl, 2,2',4,4',5,5'-hexamethoxy-1,1'-biphenyl, 2,2',4,4',5,5'-Hexamethoxybiphenyl, 2,4,5,2',4',5'-Hexamethoxy-biphenyl, 1,1'-Biphenyl,2,2',4,4',5,5'-hexamethoxy. |
| Q: What is the SMILES notation of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: SMILES notation of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is COC1=CC(=C(C=C1C2=CC(=C(C=C2OC)OC)OC)OC)OC. |
| Q: What is the boiling point of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: Boiling point of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is 402.567ºC at 760 mmHg. |
| Q: What is the molecular formula of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: Molecular formula of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is C18H22O6. |
| Q: What is the polar surface area (PSA) of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: Polar surface area (PSA) of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is 55.38000. |
| Q: What is the LogP of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: LogP of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is 3.40520. |
| Q: What is the CAS number of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: CAS number of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is 1702-67-6. |
| Q: What is the InChIKey of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene? |
| A: InChIKey of 1,2,4-trimethoxy-5-(2,4,5-trimethoxyphenyl)benzene is DLFXWDJAIBAVOY-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |