Ethanone,1,1'-(1,4-piperazinediyl)bis[2-chloro- structure
|
Common Name | Ethanone,1,1'-(1,4-piperazinediyl)bis[2-chloro- | ||
|---|---|---|---|---|
| CAS Number | 1703-23-7 | Molecular Weight | 239.09900 | |
| Density | 1.375g/cm3 | Boiling Point | 428.3ºC at 760mmHg | |
| Molecular Formula | C8H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | 2-chloro-1-[4-(2-chloroacetyl)piperazin-1-yl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375g/cm3 |
|---|---|
| Boiling Point | 428.3ºC at 760mmHg |
| Molecular Formula | C8H12Cl2N2O2 |
| Molecular Weight | 239.09900 |
| Flash Point | 212.8ºC |
| Exact Mass | 238.02800 |
| PSA | 40.62000 |
| LogP | 0.01060 |
| Vapour Pressure | 1.54E-07mmHg at 25°C |
| Index of Refraction | 1.529 |
| InChIKey | QYHXZQGNMLVJPX-UHFFFAOYSA-N |
| SMILES | O=C(CCl)N1CCN(C(=O)CCl)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N'-bis(chloroacetyl)piperazine |
| 2-chloro-1-(4-chloroacetyl-piperazin-1-yl)ethanone |
| 1,10-(piperazine-1,4-diyl(2-chloroethanone)) |
| 1,4-bis-chloroacetyl-piperazine |
| 1,1'-piperazine-1,4-diylbis(2-chloroethanone) |
| 1,4-Bis-chloracetyl-piperazin |