Carbonic acid 2,6-dimethoxy-4-(4-morpholinylcarbonyl)phenylethyl ester structure
|
Common Name | Carbonic acid 2,6-dimethoxy-4-(4-morpholinylcarbonyl)phenylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1703-31-7 | Molecular Weight | 339.34000 | |
| Density | 1.238g/cm3 | Boiling Point | 527.8ºC at 760 mmHg | |
| Molecular Formula | C16H21NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273ºC | |
| Name | [2,6-dimethoxy-4-(morpholine-4-carbonyl)phenyl] ethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 527.8ºC at 760 mmHg |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34000 |
| Flash Point | 273ºC |
| Exact Mass | 339.13200 |
| PSA | 83.53000 |
| LogP | 1.64940 |
| Vapour Pressure | 3.14E-11mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | SFVJZJHVCCHUGR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1c(OC)cc(C(=O)N2CCOCC2)cc1OC |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-dimethoxy-4-(morpholin-4-ylcarbonyl)phenyl ethyl carbonate |
| Carbonic acid,ethyl ester,ester with 4-(4-hydroxy-3,5-dimethoxybenzoyl)morpholine |
| LG 50,042 |
| 4-(4-ethoxycarbonyloxy-3,5-dimethoxy-benzoyl)-morpholine |
| Morpholine,4-(4-ethoxycarbonyloxy-3,5-dimethoxybenzoyl) |
| N-(4-Ethoxycarbonyloxy-3,5-dimethoxybenzoyl)morpholine |
| N-(3,5-Dimethoxy-4-ethoxycarbonyloxy-benzoyl)-morpholin |