[2,6-dimethoxy-4-(pyrrolidine-1-carbonyl)phenyl] ethyl carbonate structure
|
Common Name | [2,6-dimethoxy-4-(pyrrolidine-1-carbonyl)phenyl] ethyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 1703-33-9 | Molecular Weight | 323.34100 | |
| Density | 1.218g/cm3 | Boiling Point | 500.3ºC at 760 mmHg | |
| Molecular Formula | C16H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.3ºC | |
| Name | [2,6-dimethoxy-4-(pyrrolidine-1-carbonyl)phenyl] ethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 500.3ºC at 760 mmHg |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.34100 |
| Flash Point | 256.3ºC |
| Exact Mass | 323.13700 |
| PSA | 74.30000 |
| LogP | 2.41300 |
| Vapour Pressure | 3.86E-10mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | DUAIGLRNLPDQIN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1c(OC)cc(C(=O)N2CCCC2)cc1OC |
| LG 50,050 |
| N-(3,5-Dimethoxy-4-aethoxycarbonyloxy-benzoyl)-pyrrolidin |
| Carbonic acid,ethyl ester,ester with 1-(4-hydroxy-3,5-dimethoxybenzoyl)pyrrolidine |
| 1-(4-ethoxycarbonyloxy-3,5-dimethoxy-benzoyl)-pyrrolidine |
| 2,6-dimethoxy-4-(pyrrolidin-1-ylcarbonyl)phenyl ethyl carbonate |