Propanedioic acid,2-[(3-methylphenyl)amino]-, 1,3-diethyl ester structure
|
Common Name | Propanedioic acid,2-[(3-methylphenyl)amino]-, 1,3-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 17033-61-3 | Molecular Weight | 265.30500 | |
| Density | 1.145g/cm3 | Boiling Point | 357.7ºC at 760mmHg | |
| Molecular Formula | C14H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1ºC | |
| Name | diethyl 2-(3-methylanilino)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.145g/cm3 |
|---|---|
| Boiling Point | 357.7ºC at 760mmHg |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.30500 |
| Flash Point | 170.1ºC |
| Exact Mass | 265.13100 |
| PSA | 64.63000 |
| LogP | 1.97470 |
| Vapour Pressure | 2.68E-05mmHg at 25°C |
| Index of Refraction | 1.534 |
| InChIKey | UEFYOXRABYKYLD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Nc1cccc(C)c1)C(=O)OCC |
| HS Code | 2922499990 |
|---|
|
~%
Propanedioic ac... CAS#:17033-61-3 |
| Literature: O'Brien,D.E. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 1085 - 1103 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| diethyl 3-methylphenylaminomalonate |
| m-toluidino-malonic acid diethyl ester |
| 2-m-Toluidino-malonsaeure-diaethylester |
| m-Toluidino-malonsaeure-diaethylester |