2,2,2-trifluoroacetic acid compound with (4-(1-(piperazin-1-yl)ethyl)phenyl)boronic acid (1:1) structure
|
Common Name | 2,2,2-trifluoroacetic acid compound with (4-(1-(piperazin-1-yl)ethyl)phenyl)boronic acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 1704069-49-7 | Molecular Weight | 259.041 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11BFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | {3-[(4-Fluorophenyl)carbamoyl]phenyl}boronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C13H11BFNO3 |
| Molecular Weight | 259.041 |
| Exact Mass | 259.081604 |
| LogP | 2.44 |
| Index of Refraction | 1.606 |
| InChIKey | IKJQWXQYNQQZAK-UHFFFAOYSA-N |
| SMILES | CC(c1ccc(B(O)O)cc1)N1CCNCC1.O=C(O)C(F)(F)F |
| Storage condition | 2-8°C |
| Boronic acid, B-[3-[[(4-fluorophenyl)amino]carbonyl]phenyl]- |
| {3-[(4-Fluorophenyl)carbamoyl]phenyl}boronic acid |