N-ethyl-N-[tris(diethylamino)silyl]ethanamine structure
|
Common Name | N-ethyl-N-[tris(diethylamino)silyl]ethanamine | ||
|---|---|---|---|---|
| CAS Number | 17048-10-1 | Molecular Weight | 316.60100 | |
| Density | 0.885 g/cm3 | Boiling Point | 344.4ºC at 760 mmHg | |
| Molecular Formula | C16H40N4Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.1ºC | |
| Name | N-ethyl-N-[tris(diethylamino)silyl]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.885 g/cm3 |
|---|---|
| Boiling Point | 344.4ºC at 760 mmHg |
| Molecular Formula | C16H40N4Si |
| Molecular Weight | 316.60100 |
| Flash Point | 162.1ºC |
| Exact Mass | 316.30200 |
| PSA | 12.96000 |
| LogP | 2.78920 |
| Vapour Pressure | 6.61E-05mmHg at 25°C |
| Index of Refraction | 1.47 |
| InChIKey | GURMJCMOXLWZHZ-UHFFFAOYSA-N |
| SMILES | CCN(CC)[Si](N(CC)CC)(N(CC)CC)N(CC)CC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Octaethylsilanetetramine |
| EINECS 241-115-8 |
| Tetrakis-diaethylamino-silan |
| Silanetetramine,octaethyl |