3H-Indazol-3-one,1,2-dihydro-2-phenyl structure
|
Common Name | 3H-Indazol-3-one,1,2-dihydro-2-phenyl | ||
|---|---|---|---|---|
| CAS Number | 17049-65-9 | Molecular Weight | 210.23100 | |
| Density | 1.264g/cm3 | Boiling Point | 360.8ºC at 760mmHg | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172ºC | |
| Name | 2-phenyl-1H-indazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 360.8ºC at 760mmHg |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23100 |
| Flash Point | 172ºC |
| Exact Mass | 210.07900 |
| PSA | 37.79000 |
| LogP | 2.31880 |
| Vapour Pressure | 2.17E-05mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | CFNJFZDGHGYAMU-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]n1-c1ccccc1 |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-phenyl-1H-2-hydroindazol-3-one |
| 2-phenyl-1,2-dihydro-3H-indazol-3-one |
| N2-phenylindazolone |
| 3-Indazolinone,2-phenyl |
| 2-Phenyl-1,2-dihydro-indazol-3-on |
| 2-Phenyl-1,2-dihydro-indazol-3-one |