Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone structure
|
Common Name | Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1705236-57-2 | Molecular Weight | 440.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H25FN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H25FN4O2S |
|---|---|
| Molecular Weight | 440.5 |
| InChIKey | ZHRHXNJOQQEHNE-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc2nsnc2c1)N1CCC(N2CCC(Oc3ccccc3F)CC2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone? |
| A: Molecular weight of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone is 440.5. |
| Q: What is the CAS number of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone? |
| A: CAS number of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone is 1705236-57-2. |
| Q: What is the SMILES notation of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone? |
| A: SMILES notation of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone is O=C(c1ccc2nsnc2c1)N1CCC(N2CCC(Oc3ccccc3F)CC2)CC1. |
| Q: What is the molecular formula of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone? |
| A: Molecular formula of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone is C23H25FN4O2S. |
| Q: What is the InChIKey of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone? |
| A: InChIKey of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone is ZHRHXNJOQQEHNE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1705236-57-2? |
| A: Chinese name of 1705236-57-2 is 1705236-57-2. |
| Q: What is the English name of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone? |
| A: The English name of Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone is Benzo[c][1,2,5]thiadiazol-5-yl(4-(2-fluorophenoxy)-[1,4'-bipiperidin]-1'-yl)methanone. |