3-(dimethylamino)-1,2-diphenyl-2-propen-1-one structure
|
Common Name | 3-(dimethylamino)-1,2-diphenyl-2-propen-1-one | ||
|---|---|---|---|---|
| CAS Number | 17059-74-4 | Molecular Weight | 251.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(Dimethylamino)-1,2-diphenyl-2-propen-1-on |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H17NO |
|---|---|
| Molecular Weight | 251.32300 |
| Exact Mass | 251.13100 |
| PSA | 20.31000 |
| LogP | 3.47200 |
| Vapour Pressure | 4.87E-06mmHg at 25°C |
| InChIKey | BOCHZOAPGOOZEX-UHFFFAOYSA-N |
| SMILES | CN(C)C=C(C(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-dimethylamino-1,2-diphenyl-2-propen-1-one |
| (e)-3-dimethylamino-1,2-diphenyl-propenone |