5-NITRO-2-METHOXY-1-ISOPROPYLBENZOL structure
|
Common Name | 5-NITRO-2-METHOXY-1-ISOPROPYLBENZOL | ||
|---|---|---|---|---|
| CAS Number | 1706-81-6 | Molecular Weight | 195.21500 | |
| Density | 1.113g/cm3 | Boiling Point | 295.7ºC at 760 mmHg | |
| Molecular Formula | C10H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127ºC | |
| Name | 1-methoxy-4-nitro-2-propan-2-ylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 295.7ºC at 760 mmHg |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.21500 |
| Flash Point | 127ºC |
| Exact Mass | 195.09000 |
| PSA | 55.05000 |
| LogP | 3.25000 |
| Vapour Pressure | 0.00264mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | CFNOXOUAIAUFMI-UHFFFAOYSA-N |
| SMILES | COc1ccc([N+](=O)[O-])cc1C(C)C |
| HS Code | 2909309090 |
|---|
|
~%
5-NITRO-2-METHO... CAS#:1706-81-6 |
| Literature: Roche Palo Alto LLC Patent: US2007/49610 A1, 2007 ; Location in patent: Page/Page column 25 ; |
|
~69%
5-NITRO-2-METHO... CAS#:1706-81-6 |
| Literature: Chang; Chui; Tan; Yang; Zhong; Lee; Sham; Wong Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1675 - 1692 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Isopropyl-1-methoxy-4-nitrobenzene |
| 5-nitro-2-methoxy-1-isopropylbezol |
| 5-Nitro-2-methoxy-1-isopropyl-benzol |