Methyl diphenylphosphinate structure
|
Common Name | Methyl diphenylphosphinate | ||
|---|---|---|---|---|
| CAS Number | 1706-90-7 | Molecular Weight | 232.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [methoxy(phenyl)phosphoryl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H13O2P |
|---|---|
| Molecular Weight | 232.21500 |
| Exact Mass | 232.06500 |
| PSA | 36.11000 |
| LogP | 2.56190 |
| InChIKey | BHUMZHDFNOXAMC-UHFFFAOYSA-N |
| SMILES | COP(=O)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Methyl diphenylphosphinate |
| diphenylphosphinic methyl ester |
| diphenylphosphonic acid methyl ester |
| methoxy diphenylphosphine oxide |
| Phosphinic acid,diphenyl-,methyl ester |
| diphenyl-phosphinic acid,methyl ester |