S-[(4-nitrophenyl)methyl] ethanethioate
Modify Date: 2026-09-20 09:41:20
![S-[(4-nitrophenyl)methyl] ethanethioate Structure](https://image.chemsrc.com/caspic/448/170640-75-2.png)
S-[(4-nitrophenyl)methyl] ethanethioate structure
|
Common Name | S-[(4-nitrophenyl)methyl] ethanethioate | ||
|---|---|---|---|---|
| CAS Number | 170640-75-2 | Molecular Weight | 211.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | S-[(4-nitrophenyl)methyl] ethanethioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9NO3S |
|---|---|
| Molecular Weight | 211.23800 |
| Exact Mass | 211.03000 |
| PSA | 88.19000 |
| LogP | 2.89770 |
| InChIKey | HFWGVLOQUXAWPJ-UHFFFAOYSA-N |
| SMILES | CC(=O)SCc1ccc([N+](=O)[O-])cc1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| S-(4-nitrophenylmethyl)thioacetate |
| 4-Nitro-|A-toluene thioacetate |
| 4-nitrobenzyl thioacetate |
| 4-nitrobenzyl S-thioacetate |
| Ethanethioic acid,S-[(4-nitrophenyl)methyl] ester |
| S-(4-nitrobenzyl) thioacetate |
| 4-nitrophenylthiol acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: CAS number of S-[(4-nitrophenyl)methyl] ethanethioate is 170640-75-2. |
| Q: What is the molecular formula of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: Molecular formula of S-[(4-nitrophenyl)methyl] ethanethioate is C9H9NO3S. |
| Q: What is the polar surface area (PSA) of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: Polar surface area (PSA) of S-[(4-nitrophenyl)methyl] ethanethioate is 88.19000. |
| Q: What is the InChIKey of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: InChIKey of S-[(4-nitrophenyl)methyl] ethanethioate is HFWGVLOQUXAWPJ-UHFFFAOYSA-N. |
| Q: What is the English name of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: The English name of S-[(4-nitrophenyl)methyl] ethanethioate is S-[(4-nitrophenyl)methyl] ethanethioate. |
| Q: What is the Chinese name of 170640-75-2? |
| A: Chinese name of 170640-75-2 is 170640-75-2. |
| Q: What is the LogP of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: LogP of S-[(4-nitrophenyl)methyl] ethanethioate is 2.89770. |
| Q: What is the SMILES notation of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: SMILES notation of S-[(4-nitrophenyl)methyl] ethanethioate is CC(=O)SCc1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular weight of S-[(4-nitrophenyl)methyl] ethanethioate? |
| A: Molecular weight of S-[(4-nitrophenyl)methyl] ethanethioate is 211.23800. |
| Q: What English synonyms does S-[(4-nitrophenyl)methyl] ethanethioate have? |
| A: English synonyms of S-[(4-nitrophenyl)methyl] ethanethioate: S-(4-nitrophenylmethyl)thioacetate, 4-Nitro-|A-toluene thioacetate, 4-nitrobenzyl thioacetate, 4-nitrobenzyl S-thioacetate, Ethanethioic acid,S-[(4-nitrophenyl)methyl] ester, S-(4-nitrobenzyl) thioacetate, 4-nitrophenylthiol acetate. |