ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate
Modify Date: 2026-08-20 18:42:41
![ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate Structure](https://www.chemsrc.com/extcaspic/085/1707232-65-2.png)
ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate structure
|
Common Name | ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate | ||
|---|---|---|---|---|
| CAS Number | 1707232-65-2 | Molecular Weight | 231.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H21NO4 |
|---|---|
| Molecular Weight | 231.29 |
| InChIKey | JFAPXRSEKIGSOM-MRVPVSSYSA-N |
| SMILES | CCOC(=O)C(CC)NC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate? |
| A: SMILES notation of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate is CCOC(=O)C(CC)NC(=O)OC(C)(C)C. |
| Q: What is the molecular weight of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate? |
| A: Molecular weight of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate is 231.29. |
| Q: What is the molecular formula of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate? |
| A: Molecular formula of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate is C11H21NO4. |
| Q: What is the InChIKey of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate? |
| A: InChIKey of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate is JFAPXRSEKIGSOM-MRVPVSSYSA-N. |
| Q: What is the English name of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate? |
| A: The English name of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate is ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate. |
| Q: What is the CAS number of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate? |
| A: CAS number of ethyl (2R)-2-{[(tert-butoxy)carbonyl]amino}butanoate is 1707232-65-2. |
| Q: What is the Chinese name of 1707232-65-2? |
| A: Chinese name of 1707232-65-2 is 1707232-65-2. |