Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)
Modify Date: 2026-08-06 07:32:44
Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) structure
|
Common Name | Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) | ||
|---|---|---|---|---|
| CAS Number | 1707910-00-6 | Molecular Weight | 294.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H30N2S |
|---|---|
| Molecular Weight | 294.5 |
| InChIKey | YXLIYHYSFMXZFI-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(CNC(C)(C)C)C(Cc2cncs2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)? |
| A: The English name of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) is Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl). |
| Q: What is the SMILES notation of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)? |
| A: SMILES notation of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) is CC1(C)CCC(CNC(C)(C)C)C(Cc2cncs2)C1. |
| Q: What is the molecular weight of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)? |
| A: Molecular weight of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) is 294.5. |
| Q: What is the InChIKey of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)? |
| A: InChIKey of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) is YXLIYHYSFMXZFI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)? |
| A: Molecular formula of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) is C17H30N2S. |
| Q: What is the Chinese name of 1707910-00-6? |
| A: Chinese name of 1707910-00-6 is 1707910-00-6. |
| Q: What is the CAS number of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl)? |
| A: CAS number of Cyclohexanemethanamine, N-(1,1-dimethylethyl)-4,4-dimethyl-2-(5-thiazolylmethyl) is 1707910-00-6. |