3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one
Modify Date: 2025-09-10 12:54:14
3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one structure
|
Common Name | 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 1708022-34-7 | Molecular Weight | 232.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12N2O3 |
|---|---|
| Molecular Weight | 232.23 |
| InChIKey | JKFRFLXYPGHMAL-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ncc[nH]c2=O)c(OC)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one? |
| A: Molecular formula of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one is C12H12N2O3. |
| Q: What is the Chinese name of 1708022-34-7? |
| A: Chinese name of 1708022-34-7 is 1708022-34-7. |
| Q: What is the InChIKey of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one? |
| A: InChIKey of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one is JKFRFLXYPGHMAL-UHFFFAOYSA-N. |
| Q: What is the English name of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one? |
| A: The English name of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one is 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one. |
| Q: What is the molecular weight of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one? |
| A: Molecular weight of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one is 232.23. |
| Q: What is the SMILES notation of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one? |
| A: SMILES notation of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one is COc1ccc(-c2ncc[nH]c2=O)c(OC)c1. |
| Q: What is the CAS number of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one? |
| A: CAS number of 3-(2,4-Dimethoxyphenyl)pyrazin-2(1H)-one is 1708022-34-7. |