Zapalog structure
|
Common Name | Zapalog | ||
|---|---|---|---|---|
| CAS Number | 1708091-24-0 | Molecular Weight | 1108.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C58H73N7O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ZapalogZapalog is a photocleavable small-molecule heterodimerizer that can be used to repeatedly initiate, and instantaneously terminate, a physical interaction between two target proteins. Zapalog dimerizes any two proteins tagged with the FKBP and DHFR domains until exposure to light causes its photolysis[1]. |
| Name | Zapalog |
|---|
| Description | Zapalog is a photocleavable small-molecule heterodimerizer that can be used to repeatedly initiate, and instantaneously terminate, a physical interaction between two target proteins. Zapalog dimerizes any two proteins tagged with the FKBP and DHFR domains until exposure to light causes its photolysis[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C58H73N7O15 |
|---|---|
| Molecular Weight | 1108.24 |
| InChIKey | ONSMHWXTRWDIMR-SXIGHEGWSA-N |
| SMILES | CCC(C)(C)C(=O)C(=O)N1CCCCC1C(=O)OC(CCc1ccc(OC)c(OC)c1)c1cccc(NC(=O)CCCOc2cc([N+](=O)[O-])c(C(C)OCCOc3c(OC)cc(Cc4cnc(N)nc4N)cc3OC)cc2OC)c1 |