2-(4-aminophenyl)ethene-1,1,2-tricarbonitrile structure
|
Common Name | 2-(4-aminophenyl)ethene-1,1,2-tricarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 17082-33-6 | Molecular Weight | 194.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H6N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-aminophenyl)ethene-1,1,2-tricarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H6N4 |
|---|---|
| Molecular Weight | 194.19200 |
| Exact Mass | 194.05900 |
| PSA | 97.39000 |
| LogP | 2.17434 |
| InChIKey | DLKYIRGQBBRWPL-UHFFFAOYSA-N |
| SMILES | N#CC(C#N)=C(C#N)c1ccc(N)cc1 |
|
~%
2-(4-aminopheny... CAS#:17082-33-6 |
| Literature: McKusick et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 2806,2808 |
| 4-(tricyanovinyl)aniline |
| (4-Amino-phenyl)-aethentricarbonitril |
| (4-amino-phenyl)-ethenetricarbonitrile |
| Ethenetricarbonitrile,(4-aminophenyl) |