Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate
Modify Date: 2026-09-26 22:33:54
![Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate Structure](https://www.chemsrc.com/extcaspic/464/1708556-66-4.png)
Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate structure
|
Common Name | Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate | ||
|---|---|---|---|---|
| CAS Number | 1708556-66-4 | Molecular Weight | 262.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H14N2O2S |
|---|---|
| Molecular Weight | 262.33 |
| InChIKey | NUOXTEBWSUDRLE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc(NCc2nc(C)cs2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate? |
| A: InChIKey of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate is NUOXTEBWSUDRLE-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate? |
| A: SMILES notation of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate is COC(=O)c1cccc(NCc2nc(C)cs2)c1. |
| Q: What is the CAS number of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate? |
| A: CAS number of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate is 1708556-66-4. |
| Q: What is the molecular weight of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate? |
| A: Molecular weight of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate is 262.33. |
| Q: What is the English name of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate? |
| A: The English name of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate is Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate. |
| Q: What is the Chinese name of 1708556-66-4? |
| A: Chinese name of 1708556-66-4 is 1708556-66-4. |
| Q: What is the molecular formula of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate? |
| A: Molecular formula of Methyl 3-{[(4-methyl-1,3-thiazol-2-yl)methyl]amino}benzoate is C13H14N2O2S. |